Dyes, Stains, and Probes
Showing 1000 of 1082 products meeting your criteria.
ID | Code | Name | Supplier | |
---|---|---|---|---|
1703054 | CDX-R0011 | Rhodamine 123 (chloride) | Chemodex | |
1703052 | CDX-P0720 | 1-(2-Pyridylazo)-2-naphthol | Chemodex | |
1703050 | CDX-P0525 | Phenosafranin | Chemodex | |
1703047 | CDX-P0153 | 1,10-Phenanthroline | Chemodex | |
1703046 | CDX-P0147 | 1,10-Phenanthroline monohydrate | Chemodex | |
1703045 | CDX-P0144 | Phenoxazine | Chemodex | |
1703044 | CDX-O0001 | 8-Octanoyloxypyrene-1,3,6-trisulfonic acid trisodium salt | Chemodex | |
1703043 | CDX-N0353 | Naphthol AS-TR | Chemodex | |
1703039 | CDX-N0148 | Naphthol AS-MX | Chemodex | |
1703034 | CDX-L0091 | Lycopene | Chemodex | |
1703033 | CDX-I0007 | Iodonitrotetrazolium chloride | Chemodex | |
1703032 | CDX-H0928 | 7-Hydroxycoumarin-3-carboxylic acid methyl ester | Chemodex | |
1703028 | CDX-F0092 | Fluorescein dimyristate | Chemodex | |
1703023 | CDX-C1009 | 5-FAM (high purity) | Chemodex | |
1702004 | CDX-D1234 | DAF-2T Solution (5 mM in DMSO) | Chemodex | |
1702003 | CDX-D1233 | DAF-4T Solution (5 mM in DMSO) | Chemodex | |
1701999 | CDX-C0850 | o-Cresolphthalein Complexone | Chemodex | |
1701997 | CDX-C0090 | 6-ROX N-succinimidyl ester | Chemodex | |
1701996 | CDX-C0047 | 5(6)-Carboxynaphthofluorescein | Chemodex | |
1701995 | CDX-C0019 | 5-ROX N-succinimidyl ester | Chemodex | |
1701993 | CDX-B0671 | Ru(bpy)2(phen-5-NH2)(PF6)2 | Chemodex | |
1700793 | TAR-T19065 | Thiazole Orange | TargetMol | |
1700781 | TAR-T77556 | 2-(4-Hydroxyphenylazo)benzoicacid | TargetMol | |
1700655 | TAR-T5837 | Tamerit | TargetMol | |
1700106 | TAR-TD0006 | EB Eraser | TargetMol | |
1700087 | TAR-T73590 | 8-Phenyl-2,6-dibromo-1,3,5,7-tetramethyl BODIPY | TargetMol | |
1699977 | TAR-T41007 | TFAX 568, SE | TargetMol | |
1699976 | TAR-T41006 | TFAX 488,TFP | TargetMol | |
1699849 | TAR-T40375 | TFAX 594,SE | TargetMol | |
1699746 | TAR-T39759 | Janelia Fluor® 549 TFA | TargetMol | |
1699708 | TAR-T39575 | Janelia Fluor® 669, SE | TargetMol | |
1699691 | TAR-T39504 | PA Janelia Fluor® 646, SE | TargetMol | |
1699650 | TAR-T39243 | Janelia Fluor® 585, SE | TargetMol | |
1699543 | TAR-T38831 | Endoplasmic reticulum dye 1 | TargetMol | |
1699468 | TAR-T38534 | 7-TFA-ap-7-Deaza-ddA | TargetMol | |
1699466 | TAR-T38531 | 7-TFA-ap-7-Deaza-ddG | TargetMol | |
1699424 | TAR-T35151 | X-34 | TargetMol | |
1699411 | TAR-T35039 | Vat Yellow 13 | TargetMol | |
1699372 | TAR-T34922 | TRFS-red | TargetMol | |
1699350 | TAR-T34828 | Tetrapropylenebenzyl sulfonate | TargetMol | |
1699257 | TAR-T34313 | RH 421 | TargetMol | |
1699256 | TAR-T34312 | RH 160 | TargetMol | |
1699250 | TAR-T34277 | Red 21 | TargetMol | |
1699234 | TAR-T34199 | Pyrenelecithin | TargetMol | |
1699226 | TAR-T34172 | PRP-194 | TargetMol | |
1699212 | TAR-T34110 | Ponceau MX | TargetMol | |
1699208 | TAR-T34065 | Pigment Red 57 | TargetMol | |
1699207 | TAR-T34064 | Pigment Blue 15 | TargetMol | |
1699202 | TAR-T34053 | Phthalocyanine | TargetMol | |
1699135 | TAR-T33957 | PF-Alkyne | TargetMol | |
1699083 | TAR-T33694 | NK 2367 | TargetMol | |
1699015 | TAR-T33483 | Mordant red 19 | TargetMol | |
1699009 | TAR-T33413 | Mito-TRFS | TargetMol | |
1699006 | TAR-T33408 | MitoMark Green I | TargetMol | |
1698969 | TAR-T33300 | Metachrome yellow | TargetMol | |
1698790 | TAR-T32948 | Lumin | TargetMol | |
1698710 | TAR-T32519 | Lac dye | TargetMol | |
1698681 | TAR-T32265 | Janus red | TargetMol | |
1698680 | TAR-T32264 | Janus green | TargetMol | |
1698679 | TAR-T32263 | Janus blue | TargetMol | |
1698657 | TAR-T32182 | Iopydone | TargetMol | |
1698636 | TAR-T32091 | Hofman's Violet | TargetMol | |
1698563 | TAR-T31754 | FD-1080 | TargetMol | |
1698562 | TAR-T31753 | FD&C Yellow No. 5 Aluminum Lake | TargetMol | |
1698561 | TAR-T31752 | FD&C Yellow No. 4 | TargetMol | |
1698560 | TAR-T31749 | Fast Green free acid | TargetMol | |
1698542 | TAR-T31669 | ERthermAC | TargetMol | |
1698509 | TAR-T31526 | Direct Green 6 | TargetMol | |
1698497 | TAR-T31477 | Diiodofluorescein disodium salt | TargetMol | |
1698352 | TAR-T30990 | CMFDA | TargetMol | |
1698286 | TAR-T30673 | C.I. Vat Black 27 | TargetMol | |
1698285 | TAR-T30671 | C.I. Pigment Yellow 14 | TargetMol | |
1698283 | TAR-T30669 | C.I. Mordant Brown 1 | TargetMol | |
1698282 | TAR-T30668 | C.I. Food Yellow 13 | TargetMol | |
1698281 | TAR-T30667 | C.I. Food Yellow 10 | TargetMol | |
1698279 | TAR-T30664 | C.I. Basic Orange 22 | TargetMol | |
1698278 | TAR-T30663 | C.I. Acid Orange 20 | TargetMol | |
1698277 | TAR-T30662 | C.I. 74240 | TargetMol | |
1698276 | TAR-T30661 | C.I. 73336 | TargetMol | |
1698271 | TAR-T30657 | C.I. 59830 | TargetMol | |
1698269 | TAR-T30655 | Naphthol AS-BR | TargetMol | |
1698266 | TAR-T30652 | C.I. 24280 | TargetMol | |
1698264 | TAR-T30650 | C.I. 15690 | TargetMol | |
1698233 | TAR-T30474 | Bismark Brown Y | TargetMol | |
1698176 | TAR-T30377 | Benzoflavine | TargetMol | |
1698119 | TAR-T30211 | Auramine acetate | TargetMol | |
1698116 | TAR-T30180 | Astrazone pink FG | TargetMol | |
1698107 | TAR-T30144 | Arsenazo I | TargetMol | |
1698093 | TAR-T30078 | ANNINE-6plus | TargetMol | |
1698036 | TAR-T29922 | Aluminum phthalocyanine disulfonate disodium | TargetMol | |
1698034 | TAR-T29902 | Alphazurine A | TargetMol | |
1698023 | TAR-T29840 | Alcian blue | TargetMol | |
1697996 | TAR-T29624 | Acridine-3,6-diol | TargetMol | |
1697992 | TAR-T29620 | Acridine, hydrochloride | TargetMol | |
1697991 | TAR-T29619 | Acridine Yellow | TargetMol | |
1697990 | TAR-T29618 | Acridine ethidium heterodimer | TargetMol | |
1697987 | TAR-T29609 | Acid yellow 1 | TargetMol | |
1697986 | TAR-T29608 | Acid violet 43 | TargetMol | |
1697984 | TAR-T29605 | Acid Red 186 free acid | TargetMol | |
1697983 | TAR-T29604 | Acid Blue 78 | TargetMol | |
1697982 | TAR-T29603 | Acid Blue 120 parent | TargetMol | |
1697918 | TAR-T29467 | 610CP | TargetMol | |
1697386 | TAR-T21280 | Aminacrine hydrochloride monohydrate | TargetMol | |
1697290 | TAR-T20913 | Light Green SF Yellowish | TargetMol | |
1697288 | TAR-T20892 | C.I. Acid Red 4 | TargetMol | |
1697287 | TAR-T20891 | C.I. 20195 | TargetMol | |
1697286 | TAR-T20870 | IR-820 | TargetMol | |
1697277 | TAR-T20752 | Biebrich scarlet | TargetMol | |
1697268 | TAR-T20560 | C.I. Disperse Blue 3 | TargetMol | |
1697264 | TAR-T20544 | C.I. 21010 | TargetMol | |
1697258 | TAR-T20475 | Auramine free base | TargetMol | |
1697231 | TAR-T20233 | Dibenzopyrazine | TargetMol | |
1697230 | TAR-T20231 | Cellufluor | TargetMol | |
1697224 | TAR-T20184 | C.I. 67000 | TargetMol | |
1697223 | TAR-T20183 | D & C Red no. 30 | TargetMol | |
1697222 | TAR-T20180 | C.I. Vat Brown 3 | TargetMol | |
1697216 | TAR-T20150 | C.I. 37505 | TargetMol | |
1697214 | TAR-T20104 | C.I. 37545 | TargetMol | |
1697211 | TAR-T20060 | C.I. Orange G | TargetMol | |
1697209 | TAR-T20049 | FD&C Blue No. 1 aluminum lake | TargetMol | |
1697208 | TAR-T20046 | D & C Red no. 27 | TargetMol | |
1697207 | TAR-T20045 | C.I. Pigment Red 172 | TargetMol | |
1697206 | TAR-T20043 | D & C Red no. 31 | TargetMol | |
1697205 | TAR-T20034 | Solaminrot 4B | TargetMol | |
1697204 | TAR-T20032 | CI Direct Brown 2 | TargetMol | |
1697203 | TAR-T20031 | C.I. Direct Blue 2 | TargetMol | |
1697201 | TAR-T20027 | Janus green B | TargetMol | |
1697200 | TAR-T20021 | Violet bnp | TargetMol | |
1697199 | TAR-T20020 | Auramine hydrochloride | TargetMol | |
1697198 | TAR-T20014 | Patent Blue V calcium salt | TargetMol | |
1697197 | TAR-T20010 | CI Vat Green 1 | TargetMol | |
1697194 | TAR-T20002 | Acridine red | TargetMol | |
1697192 | TAR-T19996 | C.I. 37550 | TargetMol | |
1697191 | TAR-T19995 | C.I. Azoic Coupling Component 5 | TargetMol | |
1697190 | TAR-T19993 | Acid Orange 6 | TargetMol | |
1697188 | TAR-T19975 | C.I. Disperse Red 15 | TargetMol | |
1697181 | TAR-T19909 | C.I. 18760 | TargetMol | |
1697180 | TAR-T19908 | C.I. 15710 | TargetMol | |
1697179 | TAR-T19902 | C.I. 15670 | TargetMol | |
1697176 | TAR-T19879 | C.I. 13900 | TargetMol | |
1697174 | TAR-T19875 | C.I. Acid Black 24 | TargetMol | |
1697114 | TAR-T19351 | HBC599 | TargetMol | |
1697053 | TAR-T19097 | 2-Aminobenzanilide | TargetMol | |
1697049 | TAR-T19078 | (±)-ANAP | TargetMol | |
1697048 | TAR-T19064 | TAMRA-probe 1 | TargetMol | |
1697047 | TAR-T19048 | Ponatinib Acid | TargetMol | |
1697046 | TAR-T19039 | NIR-Thiol dinitrobenzenesulfonate | TargetMol | |
1697045 | TAR-T19038 | NIR-H2O2 | TargetMol | |
1697044 | TAR-T19037 | NIR dye-1 | TargetMol | |
1697043 | TAR-T19035 | Nilotinib Acid | TargetMol | |
1697042 | TAR-T19020 | L-ANAP | TargetMol | |
1697041 | TAR-T19019 | KMG-104AM | TargetMol | |
1697040 | TAR-T19016 | Indo-1 AM | TargetMol | |
1697039 | TAR-T19015 | Imatinib Acid | TargetMol | |
1697038 | TAR-T18999 | DiAzKs | TargetMol | |
1697037 | TAR-T18998 | H-L-Photo-lysine hydrochloride | TargetMol | |
1697036 | TAR-T18996 | GNF-2-PEG-acid | TargetMol | |
1697035 | TAR-T18989 | Fluo-3AM | TargetMol | |
1697034 | TAR-T18986 | Dye 993 | TargetMol | |
1697033 | TAR-T18985 | Dye 937 | TargetMol | |
1697032 | TAR-T18970 | DBCO-PEG12-TCO | TargetMol | |
1697031 | TAR-T18969 | DBCO-Cy3 | TargetMol | |
1697030 | TAR-T18959 | D-Ala-Lys-AMCA | TargetMol | |
1697029 | TAR-T18958 | D-Ala-Lys-AMCA TFA (375822-19-8 free base) | TargetMol | |
1697028 | TAR-T18955 | Cy7-YNE | TargetMol | |
1697027 | TAR-T18953 | CY7-N3 | TargetMol | |
1697026 | TAR-T18952 | Cy7 DiC18 | TargetMol | |
1697025 | TAR-T18951 | Cy7.5 | TargetMol | |
1697024 | TAR-T18948 | Cy5-DBCO | TargetMol | |
1697023 | TAR-T18947 | Cy5.5-SE | TargetMol | |
1697022 | TAR-T18941 | Cy3-N3 | TargetMol | |
1697021 | TAR-T18938 | Cy2 (iodine) | TargetMol | |
1697020 | TAR-T18936 | Cresyl Violet perchlorate | TargetMol | |
1697019 | TAR-T18926 | Biotin-probe 1 | TargetMol | |
1697018 | TAR-T18915 | Alkyne-probe 1 | TargetMol | |
1697017 | TAR-T18907 | ABL-001-Amide-PEG3-acid | TargetMol | |
1697016 | TAR-T18879 | 1,4-Dichloro 6-carboxytetramethylrhodamine | TargetMol | |
1697015 | TAR-T18878 | 1,4-Dichloro 5-carboxytetramethylrhodamine | TargetMol | |
1695602 | TAR-T17109L | TMRM | TargetMol | |
1695581 | TAR-T17060 | Tetramethylrhodamine-5-iodoacetamide | TargetMol | |
1695115 | TAR-T15790 | Lucifer Yellow CH dilithium salt | TargetMol | |
1695101 | TAR-T15593 | IQ-R | TargetMol | |
1694985 | TAR-T15135L | Direct Black 38 free acid | TargetMol | |
1694963 | TAR-T15074 | DBCO-PEG4-TAMRA | TargetMol | |
1694947 | TAR-T14985 | CLR1501 | TargetMol | |
1694425 | TAR-T13663 | Ds-HAPP | TargetMol | |
1693947 | TAR-T77564 | Coumarin102 | TargetMol | |
1693945 | TAR-T73588 | 8-(4-iodophenyl)-1,3,5,7-tetramethyl BODIPY | TargetMol | |
1693864 | TAR-T72079 | Biotin-aniline | TargetMol | |
1693586 | TAR-T60606 | Giemsa stain | TargetMol | |
1693490 | TAR-T20030 | 4',5'-Dibromofluorescein | TargetMol | |
1693446 | TAR-T77557 | Coumarin343 | TargetMol | |
1693445 | TAR-T77553 | MHI-148 | TargetMol | |
1693443 | TAR-T73589 | DK7575 | TargetMol | |
1690897 | TAR-T77263 | 10-Methyl-9-(phenoxycarbonyl)acridinium (fluorosulfonate) | TargetMol | |
1690868 | TAR-T77200 | 2-Aminopurine dihydrochloride | TargetMol | |
1690212 | TAR-T76525 | Ac-EEVVAC-pNA | TargetMol | |
1689950 | TAR-T76269 | Dnp-PLGLWA-DArg-NH2 TFA | TargetMol | |
1689948 | TAR-T76267 | Mca-PLGL-Dpa-AR-NH2 | TargetMol | |
1689905 | TAR-T76232 | Z-DEVD-AMC | TargetMol | |
1689861 | TAR-T76190 | Mca-P-Cha-G-Nva-HA-Dap(DNP)-NH2 | TargetMol | |
1689761 | TAR-T76090 | Mca-YVADAP-Lys(Dnp)-OH | TargetMol | |
1689065 | TAR-T75382 | AMCA-6-dUTP | TargetMol | |
1689064 | TAR-T75381 | Bodipy TMR-X muscimol | TargetMol | |
1689063 | TAR-T75380 | Rf470DL | TargetMol | |
1689061 | TAR-T75378 | DCDAPH | TargetMol | |
1689060 | TAR-T75377 | Thymolphthalein monophosphate disodium hydrate | TargetMol | |
1689057 | TAR-T75374 | BDP 581/591 NHS ester | TargetMol | |
1689056 | TAR-T75373 | Bz-FVR-AMC | TargetMol | |
1689055 | TAR-T75372 | BODIPY FL Thapsigargin | TargetMol | |
1689054 | TAR-T75371 | C12 NBD Sphingomyelin | TargetMol | |
1689053 | TAR-T75370 | CellTracker Blue CMF2HC Dye | TargetMol | |
1689052 | TAR-T75369 | DABCYL-Glu-Arg-Nle-Phe-Leu-Ser-Phe-Pro-EDANS | TargetMol | |
1689051 | TAR-T75368 | MTSEA-Fluorescein | TargetMol | |
1689050 | TAR-T75367 | Z-Arg-Arg-4MβNA triacetate | TargetMol | |
1689048 | TAR-T75365 | FIM-1 | TargetMol | |
1689046 | TAR-T75363 | Fluorescein Di-β-D-Glucuronide | TargetMol | |
1689043 | TAR-T75360 | Oxonol VI | TargetMol | |
1689042 | TAR-T75359 | Liperfluo | TargetMol | |
1689040 | TAR-T75357 | DMTr-4'-F-U-CED-TBDMS phosphoramidite | TargetMol | |
1689039 | TAR-T75356 | DMTr-4'-Me-U-CED-TBDMS phosphoramidite | TargetMol | |
1689033 | TAR-T75350 | Ethidium monoazide bromide | TargetMol | |
1689028 | TAR-T75345 | HKSOX-1m (5/6-mixture) (hydrobromide) | TargetMol | |
1689025 | TAR-T75341 | Biotin-16-dUTP trisodium | TargetMol | |
1689024 | TAR-T75340 | 4-Methylumbelliferyl phosphate disodium | TargetMol | |
1689022 | TAR-T75338 | Acridine Orange base | TargetMol | |
1689020 | TAR-T75336 | TO-PRO 1 | TargetMol | |
1689018 | TAR-T75334 | Methyl Green | TargetMol | |
1689016 | TAR-T75332 | 7-Hydroxy-4-methyl-2(1H)-quinolone | TargetMol | |
1688678 | TAR-T74988 | DIBA-Cy5 | TargetMol | |
1688333 | TAR-T74626 | BBR-BODIPY | TargetMol | |
1688232 | TAR-T74510 | TFMU-ADPr | TargetMol | |
1688087 | TAR-T74350 | Neuropeptide Y Y1?receptor antagonist 1 | TargetMol | |
1688004 | TAR-T74247 | TPE-MI | TargetMol | |
1687895 | TAR-T74120 | Cy5 maleimide | TargetMol | |
1687876 | TAR-T74092 | Cyanine5 alkyne | TargetMol | |
1687812 | TAR-T74013 | Geldanamycin-FITC | TargetMol | |
1687756 | TAR-T73950 | Flutax-2 (5/6-mixture) | TargetMol | |
1687745 | TAR-T73937 | HKSOX-1r (5/6-mixture) | TargetMol | |
1687744 | TAR-T73936 | HKSOX-1 (5/6-mixture) | TargetMol | |
1687483 | TAR-T73605 | 3,3'-Diethylthiacyanine iodide | TargetMol | |
1687482 | TAR-T73604 | Methyl Green zinc chloride | TargetMol | |
1684098 | TAR-T69538 | 8RK59 | TargetMol | |
1682533 | TAR-T64134 | BDP 630/650 amine | TargetMol | |
1682413 | TAR-T63980 | BODIPY FL prazosin | TargetMol | |
1679345 | TAR-T41171 | BODIPY FL VH032 | TargetMol | |
1679308 | TAR-T37756 | Phloxine B | TargetMol | |
1679272 | TAR-T35551 | Gallocyanine | TargetMol | |
1679270 | TAR-T35514 | 2,6-Dibromoquinone-4-chloroimide | TargetMol | |
1679149 | TAR-T20882 | 4-Nitrobenzoic acid | TargetMol | |
1679021 | TAR-TP1409L | CCP peptide acetate | TargetMol | |
1678718 | TAR-TD0050 | Fluo-4, pentapotassium salt | TargetMol | |
1678635 | TAR-T77698 | 1H-Benz[de]isoquinoline-1,3(2H)-dione, 2-[(4-fluorophenyl)methyl]- | TargetMol | |
1678569 | TAR-T77561 | Xylenolblue | TargetMol | |
1678560 | TAR-T77527 | XZ1208 | TargetMol | |
1678508 | TAR-T75342 | MitoSOX Red | TargetMol | |
1678457 | TAR-T72083 | Octadecyl Rhodamine B chloride | TargetMol | |
1678089 | TAR-T66518 | BODIPY-FL | TargetMol | |
1677802 | TAR-T39692 | TFAX 488,SE dilithium | TargetMol | |
1677800 | TAR-T39242 | Janelia Fluor® 646, SE | TargetMol | |
1677799 | TAR-T39241 | PA Janelia Fluor® 549, SE | TargetMol | |
1677798 | TAR-T39240 | Janelia Fluor® 549, SE | TargetMol | |
1677768 | TAR-T37764 | Cal Green™ 1 (potassium salt) | TargetMol | |
1677767 | TAR-T37762 | Fura-FF AM | TargetMol | |
1677766 | TAR-T37761 | Fura-FF (potassium salt) | TargetMol | |
1677736 | TAR-T37320 | Rhod-FF AM | TargetMol | |
1677690 | TAR-T36852 | Phalloidin-AMCA Conjugate | TargetMol | |
1677689 | TAR-T36847 | Coelenterazine hcp | TargetMol | |
1677655 | TAR-T36389 | Rhod-FF (potassium salt) | TargetMol | |
1677547 | TAR-T32039 | HADA Hydrochloride | TargetMol | |
1677446 | TAR-T19014 | Hydroxystilbamidine bis(methanesulfonate) | TargetMol | |
1677426 | TAR-T15025L | CY5 triethylamine salt | TargetMol | |
1673922 | NP-1301 | VivoVist™ Alkaline Earth Metal X-ray Contrast Agent | Nanoprobes | |
1670479 | U0557 | CFSE | Abnova Corporation | |
1670478 | U0556 | Hoechst 33342 solution | Abnova Corporation | |
1670477 | U0555 | AO solution | Abnova Corporation | |
1670476 | U0554 | PI solution | Abnova Corporation | |
1670475 | U0553 | DAPI solution | Abnova Corporation | |
1670474 | U0552 | CytoRed solution | Abnova Corporation | |
1670473 | U0551 | Calcein AM solution | Abnova Corporation | |
1661941 | CDX-T0474 | Tetrazolium Violet | Chemodex | |
1661940 | CDX-T0462 | Thionin acetate salt | Chemodex | |
1661939 | CDX-T0458 | 2,4,6-Tris(2-pyridyl)-s-triazine | Chemodex | |
1661937 | CDX-R0058 | Resorufin | Chemodex | |
1661936 | CDX-R0005 | Resorufin-beta-D-galactopyranoside | Chemodex | |
1661928 | CDX-N0529 | Naphthol AS | Chemodex | |
1661924 | CDX-N0354 | Naphthol AS acetate | Chemodex | |
1661922 | CDX-N0247 | Naphthol AS-TR phosphate disodium salt | Chemodex | |
1661921 | CDX-N0246 | Naphthol AS-MX phosphate disodium salt | Chemodex | |
1661920 | CDX-N0245 | Naphthol AS-D chloroacetate | Chemodex | |
1661919 | CDX-N0240 | Naphthol AS phosphate disodium salt | Chemodex | |
1661918 | CDX-N0239 | Naphthol AS-BI | Chemodex | |
1661917 | CDX-N0130 | Naphthol AS phosphate | Chemodex | |
1661916 | CDX-N0128 | Naphthol AS-TR phosphate | Chemodex | |
1661915 | CDX-N0127 | Naphthol AS-MX phosphate | Chemodex | |
1661914 | CDX-N0126 | Naphthol AS-BI phosphate | Chemodex | |
1661913 | CDX-N0115 | Neocuproine hemihydrate | Chemodex | |
1661905 | CDX-F0094 | Fluorescein dioctadecanoate | Chemodex | |
1661904 | CDX-F0093 | Fluorescein dipalmitate | Chemodex | |
1661903 | CDX-F0091 | Fluorescein didecanoate | Chemodex | |
1661899 | CDX-D1014 | 7-(Diethylamino)-4-(hydroxymethyl)coumarin | Chemodex | |
1661898 | CDX-D0932 | N,N-Diethyl-p-phenylenediamine sulfate salt | Chemodex | |
1661897 | CDX-D0898 | N,N-Dimethyl-p-phenylenediamine | Chemodex | |
1661895 | CDX-D0810 | Chromoionophore VI | Chemodex | |
1661891 | CDX-D0179 | Dansyl hydrazine | Chemodex | |
1661890 | CDX-D0113 | 4-Dicyanovinyljulolidine | Chemodex | |
1661888 | CDX-C0687 | 6-Carboxy-4',5'-dichloro-2',7'-dimethoxy fluorescein | Chemodex | |
1647787 | E-FN-S104 | SMCC Activated PerCP | Elabscience | |
1647786 | E-FN-S103 | SMCC Activated APC | Elabscience | |
1647785 | E-FN-S102 | SMCC Activated R-PE | Elabscience | |
1647784 | E-FN-S101 | SMCC Activated Peroxidase (HRP) | Elabscience | |
1647783 | E-FN-N104 | PerCP(Peridinin-Chlorophyll-Protein Complex) | Elabscience | |
1647782 | E-FN-N103 | APC(Allophycocyanin) | Elabscience | |
1647781 | E-FN-N102 | PE(R-Phycoerythrin) | Elabscience | |
1647780 | E-FN-L103 | Cross-Link APC | Elabscience | |
1630365 | E-CK-A161 | Propidium Iodide (PI) Staining Solution (50ug/mL) | Elabscience | |
1630364 | E-CK-A162 | 7-AAD Viability Staining Solution (100ug/mL) | Elabscience | |
1630240 | E-IR-R120 | Hematoxylin staining Buffer | Elabscience | |
1623913 | E-IR-R129 | Fast Coomassie Blue Staining Solution(10x) | Elabscience | |
1623857 | E-CK-A107 | Cell Staining Buffer | Elabscience | |
1623854 | E-CK-A163 | DAPI Staining Solution (25ug/mL) | Elabscience | |
1623853 | E-IR-R103 | DAPI Reagent | Elabscience | |
1620033 | MBL-FP00060050 | CFSE | MBL | |
1620032 | MBL-FP00050050 | Viability Dye 780 | MBL | |
1620031 | MBL-FP00050010 | Viability Dye 780 | MBL | |
1620030 | MBL-FP00040050 | Viability Dye 450 | MBL | |
1620029 | MBL-FP00040010 | Viability Dye 450 | MBL | |
1620028 | MBL-FP00030050 | Viability Dye 506 | MBL | |
1620027 | MBL-FP00030010 | Viability Dye 506 | MBL | |
1620026 | MBL-FP00020050 | 7-AAD solution | MBL | |
1620025 | MBL-FP00020020 | 7-AAD solution | MBL | |
1620024 | MBL-FP00010050 | Propidium Iodide Solution | MBL | |
1620023 | MBL-FP00010020 | Propidium Iodide Solution | MBL | |
1616748 | MBL-4700-100 | Annexin V-FITC (Reagent) | MBL | |
1607108 | LEI-P367 | Propidium iodide (PI) | Leinco Technologies | |
1606755 | LEI-A431 | 7-AAD Viability Staining Solution | Leinco Technologies | |
1599092 | CDX-T0043 | TMA-DPH | Chemodex | |
1599091 | CDX-R0137 | Rhodamine 800 | Chemodex | |
1599090 | CDX-R0020 | Resorufin acetate | Chemodex | |
1599089 | CDX-R0015 | Resorufin pentyl ether | Chemodex | |
1599088 | CDX-R0014 | Resorufin benzyl ether | Chemodex | |
1599087 | CDX-R0006 | Resorufin-beta-D-glucopyranoside | Chemodex | |
1599086 | CDX-N0244 | Naphthol AS-BI phosphate disodium salt hydrate | Chemodex | |
1599084 | CDX-D1217 | DAPI dihydrochloride Solution (10 mM in water) | Chemodex | |
1599080 | CDX-B0024 | BCIP p-toluidine salt | Chemodex | |
1599079 | CDX-A0718 | 7-Diethylamino-3-(4-aminophenyl)-4-methylcoumarin | Chemodex | |
1599078 | CDX-A0712 | Acetamidofluorescein | Chemodex | |
1599076 | CDX-A0052 | 7-Chlorobenzofurazan-4-sulfonic acid ammonium salt | Chemodex | |
1599075 | CDX-A0029 | 7-Amino-4-trifluoromethylcoumarin | Chemodex | |
1548397 | NEU-SF41000 | FluoGreen Tracer Fluoro-Stain | Neuromics | |
1545237 | ENO-EGY086 | Chloride fluorescent probe (MQAE) | Enogene Biotech | |
1545236 | ENO-EGY085 | ca2+ fluorescent probe (fluo-4) | Enogene Biotech | |
1545235 | ENO-EGY084 | ca2+ fluorescent probe (fluo-3) | Enogene Biotech | |
1545234 | ENO-EGY083 | ca2+ fluorescent probe (fluo-2) | Enogene Biotech | |
1545230 | ENO-E1WP328 | eFluor Protein Gel Stain | Enogene Biotech | |
1469004 | ENO-E37F032-100tests | Hochst33342/PI Double Staining Kit | Enogene Biotech | |
1468999 | ENO-E37F022-5mL | 2?SYBR Green qPCR Mix(including ROX) | Enogene Biotech | |
1468997 | ENO-E37F021-5mL | 2?SYBR Green qPCR Mix | Enogene Biotech | |
1468993 | ENO-E37F0032-1mL | SUPER Green I nucleic acid gel stain *10,000? concentrate in DMSO* (Mix Grade) | Enogene Biotech | |
1468991 | ENO-E37F560-1g | 7-Methoxycoumarin-3-carboxylic acid | Enogene Biotech | |
1468990 | ENO-E37F204-100mg | 6-DTAF [6-(4,6-Dichlorotriazinyl)aminofluorescein] | Enogene Biotech | |
1468989 | ENO-E37F200-100mg | 5-DTAF [5-(4,6-Dichlorotriazinyl)aminofluorescein] | Enogene Biotech | |
1468988 | ENO-E37F116-1g | 6-FAM, SE [6-Carboxyfluorescein, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1468987 | ENO-E37F1150-50mg | LipidCy3 | Enogene Biotech | |
1468986 | ENO-E37F113-1g | 5-FAM, SE [5-Carboxyfluorescein, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1468985 | ENO-E37F106-500mg | 6-FAM [6-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1468984 | ENO-E37F106-5g | 6-FAM [6-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1468983 | ENO-E37F103-500mg | 5-FAM [5-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1468982 | ENO-E37F103-5g | 5-FAM [5-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1468981 | ENO-E37F100-500mg | 5(6)-FAM [5-(and-6)-Carboxyfluorescein] *Mixed isomers* | Enogene Biotech | |
1436024 | CDX-S0012 | Stains-all | Chemodex | |
1436021 | CDX-P0038 | 4-Methylumbelliferyl palmitate | Chemodex | |
1436019 | CDX-N0028 | Naphtholfluorescein diacetate | Chemodex | |
1436017 | CDX-F0078 | Fluorescein dilaurate | Chemodex | |
1436016 | CDX-D1023 | o-Dianisidine | Chemodex | |
1436011 | CDX-C0096 | Coumarin 102 | Chemodex | |
1436010 | CDX-C0076 | Coumarin 314 | Chemodex | |
1436009 | CDX-C0075 | Coumarin 334 | Chemodex | |
1436008 | CDX-C0071 | Coumarin 7 | Chemodex | |
1436007 | CDX-C0054 | Coumarin 153 | Chemodex | |
1436006 | CDX-B0632 | Biotin-XX | Chemodex | |
1436005 | CDX-B0606 | Biotin Sulfone | Chemodex | |
1436003 | CDX-A0071 | ANTS | Chemodex | |
1435965 | CDX-D0180 | 33'-Diethyloxacarbocyanine iodide | Chemodex | |
1435964 | CDX-D0124 | 7-Diethylamino-4-methylcoumarin | Chemodex | |
1435961 | CDX-C0073 | Coumarin 343 | Chemodex | |
1435958 | CDX-B0452 | Benzo[k]fluoranthene | Chemodex | |
1435955 | CDX-O0013 | 5-(Octadecanoylamino)fluorescein | Chemodex | |
1435954 | CDX-D0241 | Dansyl fluoride | Chemodex | |
1435952 | CDX-T0008 | 6-(p-Toluidino)-2-naphthalenesulfonic acid | Chemodex | |
1435951 | CDX-T0071 | 6-(p-Toluidino)-2-naphthalenesulfonic acid sodium salt | Chemodex | |
1432852 | ELK-EQ021 | 20xSYBR Green Dye | ELK Biotechnology | |
1432846 | ELK-EQ016 | GoldView | ELK Biotechnology | |
1424358 | ENO-E37F1159-5mg | LipidCy7, SE | Enogene Biotech | |
1424357 | ENO-E37F1159-1mg | LipidCy7, SE | Enogene Biotech | |
1424356 | ENO-E37F11502-5mg | LipidCy3diacid | Enogene Biotech | |
1424355 | ENO-E37F11502-50mg | LipidCy3diacid | Enogene Biotech | |
1424354 | ENO-E37F11502-25mg | LipidCy3diacid | Enogene Biotech | |
1424353 | ENO-E37F1150-5mg | LipidCy3 | Enogene Biotech | |
1424352 | ENO-E37F1150-25mg | LipidCy3 | Enogene Biotech | |
1424304 | ENO-E37F015-1mL | PicaGreen dsDNA Assay Kit *2000 assays* | Enogene Biotech | |
1424303 | ENO-E37F017-1mL | OligoGreen ssDNA Assay Kit *2000 assays* | Enogene Biotech | |
1424302 | ENO-E37F045-1-500mL | Super ECL Plus Detection ReagentItype | Enogene Biotech | |
1424301 | ENO-E37F045-1-1L | Super ECL Plus Detection ReagentItype | Enogene Biotech | |
1424300 | ENO-E37F045-1-100mL | Super ECL Plus Detection ReagentItype | Enogene Biotech | |
1424299 | ENO-E37F045-2-500mL | Super ECL Plus Detection Reagent IItype | Enogene Biotech | |
1424298 | ENO-E37F045-2-1L | Super ECL Plus Detection Reagent IItype | Enogene Biotech | |
1424297 | ENO-E37F045-2-100mL | Super ECL Plus Detection Reagent IItype | Enogene Biotech | |
1424289 | ENO-E37F009-2mL | CelRed nucleic acid gel stain *10,000x concentrate in water* | Enogene Biotech | |
1424288 | ENO-E37F009-1mL | CelRed nucleic acid gel stain *10,000x concentrate in water* | Enogene Biotech | |
1424285 | ENO-E37F011-2mL | CelGreen nucleic acid gel stain *10,000x concentrate in water* | Enogene Biotech | |
1424284 | ENO-E37F011-1mL | CelGreen nucleic acid gel stain *10,000x concentrate in water* | Enogene Biotech | |
1424272 | ENO-E37F026-500tests | Alamar Blue Cell Viability Assay Kit | Enogene Biotech | |
1424271 | ENO-E37F026-3000tests | Alamar Blue Cell Viability Assay Kit | Enogene Biotech | |
1424270 | ENO-E37F026-100tests | Alamar Blue Cell Viability Assay Kit | Enogene Biotech | |
1424269 | ENO-E37F026-1000tests | Alamar Blue Cell Viability Assay Kit | Enogene Biotech | |
1424267 | ENO-E37F0031-1mL | SUPER Green I nucleic acid gel stain *10,000x concentrate in DMSO* (PCR Grade) | Enogene Biotech | |
1424265 | ENO-E37F023-1mL | ROX Reference Dye | Enogene Biotech | |
1424264 | ENO-E37F003-1mL | SUPER Green I nucleic acid gel stain *20x concentrate in DMSO* (PCR Grade) | Enogene Biotech | |
1424255 | ENO-E37F031-1000tests | Calcein-AM/PI Double Staining Kit | Enogene Biotech | |
1424254 | ENO-E37F030-500tests | Calcein-AM/PI Double Staining Kit | Enogene Biotech | |
1424220 | ENO-E37F20050-1g | Pluronic F-127 *Cell culture tested * | Enogene Biotech | |
1424105 | ENO-E37F633-25mg | mBBr [Monobromobimane] | Enogene Biotech | |
1424104 | ENO-E37F421-5mg | Tetramethylrhodamine-6-maleimide *Single isomer* | Enogene Biotech | |
1424103 | ENO-E37F419-5mg | Tetramethylrhodamine-5-maleimide *Single isomer* | Enogene Biotech | |
1424102 | ENO-E37F4180-25mg | Tetramethylrhodamine-5-(and-6)-maleimide *Mixed isomers* | Enogene Biotech | |
1424101 | ENO-E37F418-100mg | RBITC [Rhodamine B 5-isothiocyanate] | Enogene Biotech | |
1424100 | ENO-E37F130-25mg | Fluorescein-5-maleimide | Enogene Biotech | |
1424088 | ENO-E37F85045-25mg | Hypocrellin B | Enogene Biotech | |
1424087 | ENO-E37F85046-25mg | Hypocrellin A | Enogene Biotech | |
1424086 | ENO-E37F820-100mg | Fluorescamine | Enogene Biotech | |
1424085 | ENO-E37F204-25mg | 6-DTAF [6-(4,6-Dichlorotriazinyl)aminofluorescein] | Enogene Biotech | |
1424084 | ENO-E37F200-25mg | 5-DTAF [5-(4,6-Dichlorotriazinyl)aminofluorescein] | Enogene Biotech | |
1424083 | ENO-E37F480-10mg | Sulforhodamine 101 sulfonyl chloride | Enogene Biotech | |
1424082 | ENO-E37F470-100mg | SRB sulfonyl chloride [Sulforhodamine B sulfonyl chloride] | Enogene Biotech | |
1424081 | ENO-E37F811-50g | Dansyl chloride [5-Dimethylaminonaphthalene-1-sulfonyl chloride] | Enogene Biotech | |
1424080 | ENO-E37F2030-1g | DABSYL chloride [4-Dimethylaminoazobenzene-4-sulfonyl chloride] | Enogene Biotech | |
1424079 | ENO-E37F418-50mg | RBITC [Rhodamine B 5-isothiocyanate] | Enogene Biotech | |
1424078 | ENO-E37F418-500mg | RBITC [Rhodamine B 5-isothiocyanate] | Enogene Biotech | |
1424065 | ENO-E37F502-10mg | AMCA-X, SE [3-(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)propanoic acid, succinimidyl ester] | Enogene Biotech | |
1424064 | ENO-E37F501-25mg | AMCA acid [3-(7-amino-4-methyl-2-oxo-2H-chromen-3-yl)propanoic acid] | Enogene Biotech | |
1424063 | ENO-E37F563-25mg | 7-Methoxycoumarin-3-carboxylic acid, succinimidyl ester | Enogene Biotech | |
1424062 | ENO-E37F560-250mg | 7-Methoxycoumarin-3-carboxylic acid | Enogene Biotech | |
1424061 | ENO-E37F551-50mg | 7-Hydroxycoumarin-3-carboxylic acid, succinimidyl ester | Enogene Biotech | |
1424060 | ENO-E37F550-250mg | 7-Hydroxycoumarin-3-carboxylic acid | Enogene Biotech | |
1424059 | ENO-E37F556-25mg | 7-Hydroxy-4-methylcoumarin-3-acetic acid, succinimidyl ester | Enogene Biotech | |
1424058 | ENO-E37F554-100mg | 7-Hydroxy-4-methylcoumarin-3-acetic acid | Enogene Biotech | |
1424057 | ENO-E37F417-5mg | 6-TRITC; R isomer [Tetramethylrhodamine-6-isothiocyanate] | Enogene Biotech | |
1424053 | ENO-E37F392-5mg | 6-ROX, SE [6-Carboxy-X-rhodamine, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1424051 | ENO-E37F116-100mg | 6-FAM, SE [6-Carboxyfluorescein, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1424050 | ENO-E37F106-1g | 6-FAM [6-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1424049 | ENO-E37F342-5mg | 6-CR6G, SE [6-Carboxyrhodamine 6G, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1424048 | ENO-E37F332-5mg | 6-CR6G [6-Carboxyrhodamine 6G] *Single isomer* | Enogene Biotech | |
1424045 | ENO-E37F415-5mg | 5-TRITC; G isomer [Tetramethylrhodamine-5-isothiocyanate] | Enogene Biotech | |
1424039 | ENO-E37F113-100mg | 5-FAM, SE [5-Carboxyfluorescein, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1424038 | ENO-E37F103-1g | 5-FAM [5-Carboxyfluorescein] *Single isomer* | Enogene Biotech | |
1424037 | ENO-E37F341-5mg | 5-CR6G, SE [5-Carboxyrhodamine 6G, succinimidyl ester] *Single isomer* | Enogene Biotech | |
1424036 | ENO-E37F331-5mg | 5-CR6G [5-Carboxyrhodamine 6G] *Single isomer* | Enogene Biotech | |
1424033 | ENO-E37F410-10mg | 5(6)-TRITC [Tetramethylrhodamine-5-(and-6)-isothiocyanate] *Mixed isomers* | Enogene Biotech | |
1424027 | ENO-E37F110-1g | 5(6)-FAM, SE [5-(and-6)-Carboxyfluorescein, succinimidyl ester] *Mixed isomers* | Enogene Biotech | |
1424026 | ENO-E37F110-100mg | 5(6)-FAM, SE [5-(and-6)-Carboxyfluorescein, succinimidyl ester] *Mixed isomers* | Enogene Biotech | |
1424025 | ENO-E37F100-5g | 5(6)-FAM [5-(and-6)-Carboxyfluorescein] *Mixed isomers* | Enogene Biotech | |
1424024 | ENO-E37F100-1g | 5(6)-FAM [5-(and-6)-Carboxyfluorescein] *Mixed isomers* | Enogene Biotech | |
1424023 | ENO-E37F340-10mg | 5(6)-CR6G, SE [5-(and 6)-Carboxyrhodamine 6G, succinimidyl ester] *Mixed isomers* | Enogene Biotech | |
1424018 | ENO-E37F481-5mg | TR hydrazide [Sulforhodamine 101 sulfonyl hydrazide] | Enogene Biotech | |
1424017 | ENO-E37F482-5mg | TR cadaverine [Sulforhodamine 101 cadaverine sulfonamide] | Enogene Biotech | |
1424008 | ENO-E37F810-1g | Dansyl cadaverine [5-Dimethylaminonaphthalene-1-(N-(5-aminopentyl))sulfonamide] | Enogene Biotech | |
1424006 | ENO-E37F357-5mg | 6-TAMRA cadaverine | Enogene Biotech | |
1424005 | ENO-E37F356-5mg | 5-TAMRA cadaverine | Enogene Biotech | |
1424004 | ENO-E37F129-5mg | 5-FITC cadaverine [5-((5-Aminopentyl)thioureidyl)fluorescein] | Enogene Biotech | |
1424003 | ENO-E37F128-100mg | 5-FAM cadaverine [Fluorescein-5-carboxamide cadaverine] | Enogene Biotech | |
1424002 | ENO-E37F355-10mg | 5(6)-TAMRA cadaverine | Enogene Biotech | |
1424001 | ENO-E37F127-1g | 5(6)-FAM cadaverine [Fluorescein-5(6)-carboxamide cadaverine] | Enogene Biotech | |
1423944 | ENO-E37F035-50tests | EB Eraser | Enogene Biotech | |
1423943 | ENO-E37F035-100tests | EB Eraser | Enogene Biotech | |
1423883 | ENO-E36G108-W | Safe-White | Enogene Biotech | |
1423882 | ENO-E36G926 | SafeView FireRed | Enogene Biotech | |
1423881 | ENO-E36G108 | SafeView Classic | Enogene Biotech | |
1423880 | ENO-E36G108-R | Safe-Red | Enogene Biotech | |
1423879 | ENO-E36G108-P | Safe-Pack | Enogene Biotech | |
1423878 | ENO-E36G108-G | Safe-Green | Enogene Biotech | |
1402016 | SAv_TR | Streptavidin conjugated with Texas Red | Nordic MuBio | |
1400266 | CDX-D0064 | 2',7'-Dichlorofluorescein diacetate | Chemodex | |
1400265 | CDX-F0089 | Fluorescein dicaproate | Chemodex | |
1400262 | CDX-I0013 | Indocyanine Green [ICG] | Chemodex | |
1400255 | CDX-A0318 | 5-Aminofluorescein diacetate | Chemodex | |
1400254 | CDX-A0585 | Anthrance A | Chemodex | |
1400235 | CDX-A0669 | Acridine Orange Solution (2% in H2O) | Chemodex | |
1400234 | CDX-A0005 | Acridine Orange hydrochloride hydrate | Chemodex | |
1400230 | CDX-K0037 | Gram Staining Kit All-In-One (4 x 250ml bottles) | Chemodex | |
1400225 | CDX-B0412 | Biocytine | Chemodex | |
1400213 | CDX-M0076 | 4-Methylumbelliferyl beta-D-glucuronide dihydrate | Chemodex | |
1400200 | CDX-M0641 | Methyl Green zinc chloride salt | Chemodex | |
1400193 | CDX-T0572 | Thioxanthone | Chemodex | |
1400188 | CDX-B0264 | Bromocresol Green | Chemodex | |
1400178 | CDX-F0011 | 5-FITC | Chemodex | |
1400177 | CDX-D0150 | 2'7'-Difluorofluorescein diacetate | Chemodex | |
1400172 | CDX-D0956 | Dansylamide | Chemodex | |
1400170 | CDX-A0103 | Acridine orange 10-nonyl bromide | Chemodex | |
1400169 | CDX-F0019 | Zin3 AM | Chemodex | |
1400167 | CDX-B0070 | 4-Benzylamino-7-nitrobenzofurazan | Chemodex | |
1400160 | CDX-E0005 | Ethidium bromide | Chemodex | |
1400155 | CDX-H0015 | 7-Hydroxycoumarin-3-carboxylic acid | Chemodex | |
1400150 | CDX-L0123 | Litihium Ionophore III | Chemodex | |
1400144 | CDX-D0211 | DAF-4T | Chemodex | |
1400140 | CDX-C0334 | 6-Carboxy-2',7'-dichlorofluorescein DA | Chemodex | |
1400136 | CDX-M0034 | 3-Morpholinobenzanthrone | Chemodex | |
1400135 | CDX-D0447 | 3,3'-Diethylthiacarbocyanine iodide | Chemodex | |
1400134 | CDX-I0058 | IR-783 | Chemodex | |
1400131 | CDX-B0307 | D-Biotin p-nitrophenyl ester | Chemodex | |
1400130 | CDX-G0064 | Gram's fuchsin Solution | Chemodex | |
1400128 | CDX-A0578 | 9,10-Anthracenedipropanoic acid | Chemodex | |
1400125 | CDX-G0065 | Gram's Iodine Solution | Chemodex | |
1400124 | CDX-A0668 | Acridine Orange hemi(zinc chloride) | Chemodex | |
1400123 | CDX-F0059 | Ferrozine monosodium salt hydrate | Chemodex | |
1400122 | CDX-P0068 | PBFI-AM | Chemodex | |
1400121 | CDX-C0068 | N-Dansylethylenediamine | Chemodex | |
1400120 | CDX-F0013 | Fura-2 pentapotassium salt | Chemodex | |
1400119 | CDX-D0282 | Dibenzylfluorescein | Chemodex | |
1400118 | CDX-C0686 | Calcein-AM Solution | Chemodex | |
1400117 | CDX-C0658 | Calcein-AM Solution | Chemodex | |
1400116 | CDX-B0445 | 5,5'-Difluoro BAPTA-AM | Chemodex | |
1400115 | CDX-B0285 | BAPTA-AM | Chemodex | |
1400112 | CDX-B0448 | Hoechst 34580 Solution | Chemodex | |
1400111 | CDX-F0088 | Fluorescein dipropionate | Chemodex | |
1400110 | CDX-F0087 | Fluorescein dioctanoate | Chemodex | |
1400107 | CDX-D0711 | 7-Dimethylamino-4-methylcoumarin | Chemodex | |
1400099 | CDX-D0043 | Dansyl chloride | Chemodex | |
1400098 | CDX-C0577 | 4-Chloro-2,1,3-benzoxadiazole | Chemodex | |
1400097 | CDX-B0446 | Hoechst 33258 Solution | Chemodex | |
1400096 | CDX-B0447 | Hoechst 33342 Solution | Chemodex | |
1400095 | CDX-B0217 | BAPTA (free acid) | Chemodex | |
1400065 | CDX-P0593 | Psoralen | Chemodex | |
1400043 | CDX-H0008 | 7-Hydroxy-4-coumarinylacetic acid | Chemodex | |
1400000 | CDX-D0381 | Dihydromyricetin | Chemodex | |
1169744 | ENO-EGY061 | Golgi-Red Probes | Enogene Biotech | |
1169743 | ENO-EGY060 | Golgi-Green Probes (NBD C6-Ceramide ) | Enogene Biotech | |
1169740 | ENO-EGY057 | ER-Red Probes | Enogene Biotech | |
1169739 | ENO-EGY056 | ER-Green Probes | Enogene Biotech | |
1169738 | ENO-EGY055 | Lyso-Yellow/Blue Probes | Enogene Biotech | |
1169737 | ENO-EGY054 | Lyso-Yellow/Blue dextran, 10,000 MW, Anionic, Fixable | Enogene Biotech | |
1169736 | ENO-EGY053 | Lyso-Red Probes | Enogene Biotech | |
1169735 | ENO-EGY052 | Lyso-Green Probes | Enogene Biotech | |
1169734 | ENO-EGY051 | Lyso-Blue Probes | Enogene Biotech | |
1169733 | ENO-EGY050 | MitoSox Red | Enogene Biotech | |
1169728 | ENO-EGY045 | DiOC6(3) iodide | Enogene Biotech | |
1169727 | ENO-EGY044 | Rhodamine 123 | Enogene Biotech | |
1169726 | ENO-EGY043 | Rhodamine 123 Solution | Enogene Biotech | |
1169725 | ENO-EGY042 | Mito DeepRed Probes | Enogene Biotech | |
1169724 | ENO-EGY041 | Mito-Red Probes CMXRos | Enogene Biotech | |
1169723 | ENO-EGY040 | Mito-Orange Probes CMTMRos | Enogene Biotech | |
1169722 | ENO-EGY039 | Mito-Green Probes | Enogene Biotech | |
1169721 | ENO-EGY038 | Tubulin-Red Probes | Enogene Biotech | |
1169720 | ENO-EGY037 | Actin-Red Probes | Enogene Biotech | |
1169719 | ENO-EGY036 | Actin-Green Probes | Enogene Biotech | |
1169718 | ENO-EGY035 | Actin-Blue Probes | Enogene Biotech | |
1169717 | ENO-EGY034 | DiIC16(3 ) perchlorate | Enogene Biotech | |
1169716 | ENO-EGY033 | DiOC16(3) perchlorate | Enogene Biotech | |
1169715 | ENO-EGY032 | DiIC12(3) perchlorate | Enogene Biotech | |
1169714 | ENO-EGY031 | DiR Cell Labeling Solution | Enogene Biotech | |
1169713 | ENO-EGY030 | DiR iodide | Enogene Biotech | |
1169712 | ENO-EGY029 | DiD Cell Labeling Solution | Enogene Biotech | |
1169711 | ENO-EGY028 | DiD perchlorate | Enogene Biotech | |
1169710 | ENO-EGY027 | DiI Cell Labeling Solution | Enogene Biotech | |
1169709 | ENO-EGY026 | DiI perchlorate | Enogene Biotech | |
1169708 | ENO-EGY025 | DiO Cell Labeling Solution | Enogene Biotech | |
1169707 | ENO-EGY024 | DiO perchlorate | Enogene Biotech | |
1169706 | ENO-EGY023 | DiA iodide | Enogene Biotech | |
1169705 | ENO-EGY022 | NO Probes | Enogene Biotech | |
1169704 | ENO-EGY021 | DHE [Dihydroethidium] | Enogene Biotech | |
1169703 | ENO-EGY020 | ROS Probes H2DCFDA | Enogene Biotech | |
1052060 | ENO-ETF1082 | MQAE (Cl- probe) | Enogene Biotech | |
1052059 | ENO-ETF1056 | Fluo-3 AM (Ca2+ probe) | Enogene Biotech | |
1052058 | ENO-ETF1052 | Fura-2 AM | Enogene Biotech | |
1052057 | ENO-ETF1050 | Tubulin-Tracker Red | Enogene Biotech | |
1052056 | ENO-ETF1048 | Mito-Tracker Green (mitochondria probe) | Enogene Biotech | |
1052055 | ENO-ETF1046 | Lyso-Tracker Red (lysosome probe) | Enogene Biotech | |
1052054 | ENO-ETF1038 | DiO (cell membrane green probe) | Enogene Biotech | |
1052053 | ENO-ETF1036 | DiI (cell membrane red probe) | Enogene Biotech | |
1052051 | ENO-ETF1006 | BCECF AM (pH probe) | Enogene Biotech | |
1052050 | ENO-ETF0063 | Dihydroethidium | Enogene Biotech | |
1052037 | ENO-E22-NS000 | IHCDAB solution | Enogene Biotech | |
1051178 | CDX-T0002 | TMB | Chemodex | |
1051130 | CDX-B0310 | Sulfo-NHS-LC-Biotin | Chemodex | |
1051128 | CDX-B0308 | (+)-Biotin-PFP-ester | Chemodex | |
1051126 | CDX-B0145 | (+)-Biotin N-hydroxysuccinimide ester | Chemodex | |
1051124 | CDX-B0143 | Biotin-X | Chemodex | |
1051123 | CDX-B0139 | Biotin-X-NHS | Chemodex | |
1032605 | CDX-T0513 | Thiazole Orange Solution | Chemodex | |
1032602 | CDX-T0186 | Thiazolyl blue tetrazolium bromide | Chemodex | |
1032598 | CDX-N0249 | Neutral Red 5 | Chemodex | |
1032592 | CDX-N0116 | alpha-Naphtholbenzein | Chemodex | |
1032588 | CDX-M0012 | 4-Methylumbelliferyl phosphate disodium salt | Chemodex | |
1032586 | CDX-L0009 | D-Luciferin potassium salt | Chemodex | |
1032584 | CDX-H0926 | HITCI | Chemodex | |
1032583 | CDX-H0295 | Dimethylindodicarbocyanine | Chemodex | |
1032571 | CDX-D0806 | 1,1'-Dibutyl-3,3,3',3'-tetramethylindotricarbocyanine hexafluorophosphate | Chemodex | |
1032570 | CDX-D0516 | DAF-4 DA Solution | Chemodex | |
1032568 | CDX-B0279 | Basic Red 12 | Chemodex | |
1007754 | CDX-D0025 | DAPI dihydrochloride | Chemodex | |
1007748 | CDX-C0252 | Crystal Violet | Chemodex | |
1007746 | CDX-C0242 | o-Cresolphthalein | Chemodex | |
980855 | CDX-D0216 | DAF-4 DA | Chemodex | |
980851 | CDX-C0027 | 5(6)-TAMRA N-succinimidyl ester | Chemodex | |
980842 | CDX-D0214 | DAR-2T | Chemodex | |
976721 | CDX-S0116 | Safranin O | Chemodex | |
976718 | CDX-N0147 | NBD dodecanoic acid N-succinimidyl ester | Chemodex | |
976717 | CDX-N0045 | NBD-X SE | Chemodex | |
976711 | CDX-H0021 | 8-Hydroxyjulolidine-9-aldehyde | Chemodex | |
976706 | CDX-G0061 | Gram's Safranin Solution | Chemodex | |
976704 | CDX-G0060 | Gram's Crystal Violet Solution | Chemodex | |
976698 | CDX-D0202 | 4'-Diethylamino-3-hydroxyflavone | Chemodex | |
976696 | CDX-D0120 | 10-Dodecylacridine Orange Bromide | Chemodex | |
976682 | CDX-A0250 | 5(6)-Amino-TAMRA | Chemodex | |
967809 | CDX-M0051 | 6-Methoxy-N-(3-sulfopropyl)quinolinium | Chemodex | |
967800 | CDX-F0111 | 6-FITC | Chemodex | |
967797 | CDX-F0027 | Fluorescein diacetate | Chemodex | |
967793 | CDX-D0164 | 6,8-Difluoro-7-ethoxy-4-methylcoumarin | Chemodex | |
967791 | CDX-D0059 | 6,8-Difluoro-7-hydroxy-4-methylcumarin | Chemodex | |
967787 | CDX-C0333 | 5-Carboxy-2',7'-dichlorofluorescein DA | Chemodex | |
967773 | CDX-A0307 | 6-Aminoseleno-D-luciferin | Chemodex | |
896447 | CDX-B0078 | Biotin-(5-fluorescein)-conjugate | Chemodex | |
896444 | CDX-H0022 | 4-Hydrazino-7-nitro-2,1,3-benzoxadiazol | Chemodex | |
896440 | CDX-I0063 | Indigo Carmine | Chemodex | |
896427 | CDX-Z0028 | Zincon monosodium salt | Chemodex | |
896404 | CDX-B0022 | 4-Bromomethyl-7-methoxycoumarin | Chemodex | |
896398 | CDX-F0037 | 6-(Fluorescein-6-carboxamido)hexanoic acid | Chemodex | |
896394 | CDX-F0015 | 6-(Fluorescein-5(6)-carboxamido)hexanoic acid | Chemodex | |
896386 | CDX-F0036 | 6-(Fluorescein-5-carboxamido)hexanoic acid | Chemodex | |
896377 | CDX-C0009 | Calcein-AM | Chemodex | |
896375 | CDX-F0048 | 6-(Fluorescein-6-carboxamido)hexanoic acid N-succinimidyl ester | Chemodex | |
896373 | CDX-F0035 | 6-(Fluorescein-5-carboxamido)hexanoic acid N-succinimidyl ester | Chemodex | |
896371 | CDX-B0292 | MAPTAM | Chemodex | |
896369 | CDX-D0169 | AGD | Chemodex | |
896368 | CDX-A0072 | Rhod 2-AM | Chemodex | |
896366 | CDX-H0054 | Nitrate Ionophore VI | Chemodex | |
896360 | CDX-C0098 | 6-Carboxy-4'5'-dichloro-2' 7'-dimethoxyfluorescein succinimidyl ester | Chemodex | |
896359 | CDX-I0019 | Indo 1-AM | Chemodex | |
896358 | CDX-F0014 | FURA 2-AM | Chemodex | |
896352 | CDX-A0193 | 1,3-bis(Aminooxy)propan dihydrochloride | Chemodex | |
896349 | CDX-D0189 | Dansylcadaverine | Chemodex | |
837747 | AG-CY1-0002 | 5-Dodecanoylaminofluorescein di-beta-D-glucuronide | AdipoGen Life Sciences | |
796338 | CDX-Z0507 | ZnAF-1 DA Solution | Chemodex | |
796335 | CDX-D0253 | DTTCI | Chemodex | |
796108 | CDX-H0070 | N-Hexadecylpyrene-1-sulfonamide | Chemodex | |
796099 | CDX-F0044 | 6-(Fluorescein-5(6)-carboxamido)hexanoicacid N-succinimidyl ester | Chemodex | |
796093 | CDX-D0436 | 3,8-Diamino-6-phenylphenanthridine | Chemodex | |
796090 | CDX-C0603 | BCECF-AM Solution | Chemodex | |
796087 | CDX-C0231 | Chromotropic acid disodium salt dihydrate | Chemodex | |
796085 | CDX-C0029 | Coumarin-6-sulfonyl chloride | Chemodex | |
796084 | CDX-C0011 | 5(6)-FAM N-succinimidyl ester | Chemodex | |
791829 | U0334 | Hoechst 33342 | Abnova Corporation | |
791828 | U0333 | Calcein AM | Abnova Corporation | |
791827 | U0332 | Propidium Iodide | Abnova Corporation | |
791826 | U0331 | DAPI | Abnova Corporation | |
788244 | NP-6010 | EnzMet for General Research Applications | Nanoprobes | |
788243 | NP-6002 | EnzMet Western Blot HRP Detection Kit | Nanoprobes | |
788242 | NP-6001 | EnzMet IHC / ISH HRP Detection Kit | Nanoprobes | |
782853 | CDX-Z0512 | ZnAF-2F DA Solution | Chemodex | |
782852 | CDX-Z0511 | ZnAF-1F DA Solution | Chemodex | |
782851 | CDX-Z0510 | ZnAF-2F Solution | Chemodex | |
782850 | CDX-Z0509 | ZnAF-1F Solution | Chemodex | |
782849 | CDX-Z0508 | ZnAF-2 DA Solution | Chemodex | |
782847 | CDX-Z0506 | ZnAF-2 Solution | Chemodex | |
782846 | CDX-Z0505 | ZnAF-1 Solution | Chemodex | |
782844 | CDX-S0077 | Red C2-dichlorotriazine | Chemodex | |
782838 | CDX-D0602 | DAR-2 Solution | Chemodex | |
782837 | CDX-D0601 | DAR-1 Solution | Chemodex | |
782836 | CDX-D0585 | DAF-2 DA Solution | Chemodex | |
782835 | CDX-D0584 | DAF-2 Solution | Chemodex | |
782834 | CDX-D0576 | DAR-4 Solution | Chemodex | |
782833 | CDX-D0575 | DAR-4T Solution | Chemodex | |
782832 | CDX-D0574 | DAR-MT Solution | Chemodex | |
782831 | CDX-D0544 | DAF-2T Solution | Chemodex | |
782830 | CDX-D0521 | DAR-M Solution | Chemodex | |
782829 | CDX-D0520 | DAR-4MT Solution | Chemodex | |
782828 | CDX-D0513 | DAR-1T Solution | Chemodex | |
782827 | CDX-D0506 | DAR-4M Solution | Chemodex | |
782809 | CDX-A0177 | 4-Azido-4-nitro-2,1,3-benzoxadiazole | Chemodex | |
782807 | CDX-A0176 | 7-Amino-4-nitro-2,1,3-benzoxadiazole | Chemodex | |
782795 | CDX-P0523 | Propidium Iodide Solution | Chemodex | |
782787 | CDX-M0219 | 4-Methylumbelliferyl nonanoate | Chemodex | |
782785 | CDX-M0218 | 4-Methylumbelliferyl octanoate | Chemodex | |
782781 | CDX-L0012 | Luminol | Chemodex | |
782779 | CDX-H0028 | 5-Hexadecanoylaminofluorescein | Chemodex | |
782772 | CDX-E0512 | Ethidium homodimer Solution | Chemodex | |
782763 | CDX-D0162 | 5-Dodecanoylaminofluorescein | Chemodex | |
782758 | CDX-D0063 | DCFDA | Chemodex | |
782749 | CDX-B0148 | D-Biotin | Chemodex | |
782747 | CDX-B0146 | BHHT | Chemodex | |
782738 | CDX-A0524 | DAF-FM DA Solution | Chemodex | |
782737 | CDX-A0523 | DAF-FM Solution | Chemodex | |
748621 | CDX-Z0006 | ZnAF-2 | Chemodex | |
748620 | CDX-R0022 | Rhodamine 6G ethylenediamine amide bis (trifluoroacetate) | Chemodex | |
748618 | CDX-P0006 | 12-(1-Pyrenyl) dodecanoic acid | Chemodex | |
748617 | CDX-E0012 | Ethidium homodimer | Chemodex | |
747719 | CDX-X0006 | Xylenol Blue | Chemodex | |
747710 | CDX-T0103 | JC-10 | Chemodex | |
747706 | CDX-S0035 | Red Starch | Chemodex | |
747704 | CDX-S0025 | Sulforhodamine 101 | Chemodex | |
747703 | CDX-R0054 | Red Arabinan | Chemodex | |
747701 | CDX-R0032 | Rhodamine 6G | Chemodex | |
747699 | CDX-R0016 | Rhodamine 110 chloride | Chemodex | |
747683 | CDX-P0021 | 1,3,6,8-Pyrenetetrasulfonic acid tetrasodium salt | Chemodex | |
747663 | CDX-M0096 | 2'-(4-Methylumbelliferyl)-alpha-D-N-acetylneuraminic acid sodium salt hydrate | Chemodex | |
747659 | CDX-M0028 | 7-Methoxycoumarin-4-acetic acid | Chemodex | |
747641 | CDX-H0026 | 5,7-Dihydroxytryptamine hydrobromide | Chemodex | |
747636 | CDX-F0023 | Fluorescein (free acid) | Chemodex | |
747620 | CDX-D0329 | 2,4-Difluororesorcinol | Chemodex | |
747615 | CDX-D0213 | DAR-1T | Chemodex | |
747605 | CDX-D0004 | 2',7'-Dichlorofluorescein | Chemodex | |
747596 | CDX-C0187 | 6-HEX dipivaloate | Chemodex | |
747587 | CDX-C0017 | 6-FAM N-succinimidyl ester | Chemodex | |
747584 | CDX-C0015 | 5-FAM N-succinimidyl ester | Chemodex | |
747569 | CDX-B0134 | Di-(2-picolyl)amine | Chemodex | |
747562 | CDX-A0221 | Azo-Carob Galactomannan | Chemodex | |
747553 | CDX-A0149 | Azomethine-H monosodium salt hydrate | Chemodex | |
733789 | AG-CR1-3600 | JC-10 (high purity) | AdipoGen Life Sciences | |
733598 | CDX-X0009 | Xylidyl blue I | Chemodex | |
733597 | CDX-W0001 | WSP1 | Chemodex | |
733591 | CDX-T0151 | TMB dihydrochloride | Chemodex | |
733581 | CDX-T0080 | 2,3,3-Trimethylindolenine | Chemodex | |
733567 | CDX-O0047 | 7-[(2-Oxocyclopentyl)oxy]-2H-1-benzopyran-2-one | Chemodex | |
733565 | CDX-O0046 | 7-(2-Oxiranylethoxy)-2H-1-benzopyran-2-one | Chemodex | |
733562 | CDX-O0008 | o-Phthaldialdehyde | Chemodex | |
733557 | CDX-M0098 | 3'-O-Methylfluorescein | Chemodex | |
733531 | CDX-F0056 | Fluo-3 | Chemodex | |
733530 | CDX-F0003 | Fluorescamine | Chemodex | |
733519 | CDX-D0393 | DSP-3 | Chemodex | |
733516 | CDX-D0392 | DSP-2 | Chemodex | |
733513 | CDX-D0391 | DSP-1 | Chemodex | |
733511 | CDX-D0276 | DAR-4 | Chemodex | |
733509 | CDX-D0275 | DAR-4T | Chemodex | |
733507 | CDX-D0274 | DAR-MT | Chemodex | |
733505 | CDX-D0220 | DAR-4MT | Chemodex | |
733503 | CDX-D0206 | DAR-4M | Chemodex | |
733495 | CDX-D0121 | DAR-M | Chemodex | |
733493 | CDX-D0079 | 6,8-Difluoro-7-hydroxy-2-oxo-2H-1-benzopyran-3-carboxylic acid | Chemodex | |
733484 | CDX-A0308 | Arsenazo III | Chemodex | |
733475 | CDX-A0069 | 7-Azido-4-methylcoumarin | Chemodex | |
733442 | AG-CMA-1005 | LysoGlow84 | AdipoGen Life Sciences | |
731857 | CDX-S0037 | SNARF-DE | Chemodex | |
731853 | CDX-P0134 | Potassium tetrakis(4-chlorophenyl)borate | Chemodex | |
731809 | CDX-N0107 | Nile Red | Chemodex | |
731804 | CDX-N0051 | 1(H)-Naphthotriazol | Chemodex | |
731801 | CDX-N0035 | NIR 4d | Chemodex | |
731800 | CDX-N0009 | Nitrotetrazolium blue chloride | Chemodex | |
731783 | CDX-M0046 | 7-Methoxy-4-methylcoumarin | Chemodex | |
731725 | CDX-E0013 | Eosin-5-isothiocyanate | Chemodex | |
731714 | CDX-D0330 | 3,5-Difluoro-2,4-dihydroxybenzaldehyde | Chemodex | |
731708 | CDX-D0313 | 1-(4-Dimethylamino-phenyl)-2-phenanthridin-6-yl-ethanone | Chemodex | |
731706 | CDX-D0310 | 4-Dimethylaminocinnamaldehyde | Chemodex | |
731696 | CDX-D0123 | 5-DTAF hydrochloride | Chemodex | |
731676 | CDX-C0051 | 5-CFDA ethanedioic-S-phenylmethyl ester | Chemodex | |
731675 | CDX-C0036 | 3-Carboxy-6,8-difluoro-7-hydroxycoumarin | Chemodex | |
731670 | CDX-B0270 | Biotinyl tyramide | Chemodex | |
731666 | CDX-B0268 | N-(3-Bromopropyl)-7-nitro-2,1,3-benzoxadiazol-4-amine | Chemodex | |
731659 | CDX-B0091 | 4-(Bromomethyl)phenyl isothiocyanate | Chemodex | |
713194 | U0313 | Fluorescent Dye Tetramethylrhodamine Phalloidin | Abnova Corporation | |
713192 | U0311 | Fluorescent Dye Fluorescein Phalloidin | Abnova Corporation | |
713191 | U0310 | Fluorescent Dye Eu-Streptavidin | Abnova Corporation | |
713190 | U0309 | Fluorescent Dye California Red Phalloidin | Abnova Corporation | |
713189 | U0308 | Fluorescent Dye AMCA Phalloidin | Abnova Corporation | |
713188 | U0307 | Fluorescent Dye 790-I Phalloidin | Abnova Corporation | |
713187 | U0306 | Fluorescent Dye 780-M Streptavidin | Abnova Corporation | |
713186 | U0305 | Fluorescent Dye 750-I Phalloidin | Abnova Corporation | |
713185 | U0304 | Fluorescent Dye 750-I Streptavidin | Abnova Corporation | |
713184 | U0303 | Fluorescent Dye 700-M Streptavidin | Abnova Corporation | |
713183 | U0302 | Fluorescent Dye 700-I Phalloidin | Abnova Corporation | |
713182 | U0301 | Fluorescent Dye 700-I Streptavidin | Abnova Corporation | |
713181 | U0300 | Fluorescent Dye 680-I Phalloidin | Abnova Corporation | |
713180 | U0299 | Fluorescent Dye 680-I Streptavidin | Abnova Corporation | |
713179 | U0298 | Fluorescent Dye 647-I Phalloidin | Abnova Corporation | |
713178 | U0297 | Fluorescent Dye 647-I Streptavidin | Abnova Corporation | |
713177 | U0296 | Fluorescent Dye 633-I Phalloidin | Abnova Corporation | |
713176 | U0295 | Fluorescent Dye 633-I Streptavidin | Abnova Corporation | |
713175 | U0294 | Fluorescent Dye 630-M Streptavidin | Abnova Corporation | |
713174 | U0293 | Fluorescent Dye 620-M Streptavidin | Abnova Corporation | |
713173 | U0292 | Fluorescent Dye 594-I Phalloidin | Abnova Corporation | |
713172 | U0291 | Fluorescent Dye 594-I Streptavidin | Abnova Corporation | |
713171 | U0290 | Fluorescent Dye 570-M Streptavidin | Abnova Corporation | |
713170 | U0289 | Fluorescent Dye 555-I Phalloidin | Abnova Corporation | |
713169 | U0288 | Fluorescent Dye 555-I Streptavidin | Abnova Corporation | |
713168 | U0287 | Fluorescent Dye 540-M Streptavidin | Abnova Corporation | |
713167 | U0286 | Fluorescent Dye 532-I Phalloidin | Abnova Corporation | |
713166 | U0285 | Fluorescent Dye 532-I Streptavidin | Abnova Corporation | |
713165 | U0284 | Fluorescent Dye 514-I Phalloidin | Abnova Corporation | |
713164 | U0283 | Fluorescent Dye 514-I Streptavidin | Abnova Corporation | |
713163 | U0282 | Fluorescent Dye 510-M Streptavidin | Abnova Corporation | |
713162 | U0281 | Fluorescent Dye 488-I Phalloidin | Abnova Corporation | |
713161 | U0280 | Fluorescent Dye 488-I Streptavidin | Abnova Corporation | |
713160 | U0279 | Fluorescent Dye 450-M Streptavidin | Abnova Corporation | |
713159 | U0278 | Fluorescent Dye 405-I Phalloidin | Abnova Corporation | |
713158 | U0277 | Fluorescent Dye 405-I Streptavidin | Abnova Corporation | |
713157 | U0276 | Fluorescent Dye 350-I Phalloidin | Abnova Corporation | |
713156 | U0275 | Fluorescent Dye 350-I Streptavidin | Abnova Corporation | |
713155 | U0274 | Fluorescent Dye 780-M Succinimidyl Ester (Red) | Abnova Corporation | |
713154 | U0273 | Fluorescent Dye 700-M Succinimidyl Ester (Red) | Abnova Corporation | |
713152 | U0271 | Fluorescent Dye 620-M Succinimidyl Ester (Green) | Abnova Corporation | |
713151 | U0270 | Fluorescent Dye 570-M Succinimidyl Ester (Blue) | Abnova Corporation | |
713150 | U0269 | Fluorescent Dye 540-M Succinimidyl Ester (Violet) | Abnova Corporation | |
713149 | U0268 | Fluorescent Dye 510-M Succinimidyl Ester (Violet) | Abnova Corporation | |
713148 | U0267 | Fluorescent Dye 450-M Succinimidyl Ester (Violet) | Abnova Corporation | |
713147 | U0266 | Fluorescent Dye 790-I Succinimidyl Ester | Abnova Corporation | |
713146 | U0265 | Fluorescent Dye 790-I Maleimide | Abnova Corporation | |
713145 | U0264 | Fluorescent Dye 790-I Hydrazide | Abnova Corporation | |
713144 | U0263 | Fluorescent Dye 790-I Amine | Abnova Corporation | |
713143 | U0262 | Fluorescent Dye 790-I Acid | Abnova Corporation | |
713142 | U0261 | Fluorescent Dye 750-I Hydrazide | Abnova Corporation | |
713141 | U0260 | Fluorescent Dye 750-I Maleimide | Abnova Corporation | |
713140 | U0259 | Fluorescent Dye 750-I Succinimidyl Ester | Abnova Corporation | |
713139 | U0258 | Fluorescent Dye 700-I Hydrazide | Abnova Corporation | |
713138 | U0257 | Fluorescent Dye 700-I Maleimide | Abnova Corporation | |
713137 | U0256 | Fluorescent Dye 700-I Succinimidyl Ester | Abnova Corporation | |
713136 | U0255 | Fluorescent Dye 680-I Hydrazide | Abnova Corporation | |
713135 | U0254 | Fluorescent Dye 680-I Maleimide | Abnova Corporation | |
713134 | U0253 | Fluorescent Dye 680-I Succinimidyl Ester | Abnova Corporation | |
713133 | U0252 | Fluorescent Dye 647-I Azide | Abnova Corporation | |
713132 | U0251 | Fluorescent Dye 647-I Alkyne | Abnova Corporation | |
713131 | U0250 | Fluorescent Dye 647-I Hydrazide | Abnova Corporation | |
713130 | U0249 | Fluorescent Dye 647-I Maleimide | Abnova Corporation | |
713129 | U0248 | Fluorescent Dye 647-I Succinimidyl Ester | Abnova Corporation | |
713128 | U0247 | Fluorescent Dye 633-I Succinimidyl Ester | Abnova Corporation | |
713127 | U0246 | Fluorescent Dye 610-I Succinimidyl Ester | Abnova Corporation | |
713126 | U0245 | Fluorescent Dye 594-I Succinimidyl Ester | Abnova Corporation | |
713125 | U0244 | Fluorescent Dye 555-I Hydrazide | Abnova Corporation | |
713124 | U0243 | Fluorescent Dye 555-I Maleimide | Abnova Corporation | |
713123 | U0242 | Fluorescent Dye 555-I Succinimidyl Ester | Abnova Corporation | |
713122 | U0241 | Fluorescent Dye 532-I Succinimidyl Ester | Abnova Corporation | |
713121 | U0240 | Fluorescent Dye 514-I Succinimidyl Ester | Abnova Corporation | |
713120 | U0239 | Fluorescent Dye 488-I Hydrazide | Abnova Corporation | |
713119 | U0238 | Fluorescent Dye 488-I Maleimide | Abnova Corporation | |
713118 | U0237 | Fluorescent Dye 488-I Succinimidyl Ester | Abnova Corporation | |
713117 | U0236 | Fluorescent Dye 405-I Succinimidyl Ester | Abnova Corporation | |
713116 | U0235 | Fluorescent Dye 350-I Hydrazide | Abnova Corporation | |
713115 | U0234 | Fluorescent Dye 350-I Maleimide | Abnova Corporation | |
713114 | U0233 | Fluorescent Dye 350-I Succinimidyl Ester | Abnova Corporation | |
713113 | U0232 | Fluorescent Dye 678-C5.5 Alkyne | Abnova Corporation | |
713112 | U0231 | Fluorescent Dye 678-C5.5 Azide | Abnova Corporation | |
713111 | U0230 | Fluorescent Dye 678-C5.5 Hydrazide | Abnova Corporation | |
713110 | U0229 | Fluorescent Dye 678-C5.5 Amine | Abnova Corporation | |
713109 | U0228 | Fluorescent Dye 678-C5.5 Maleimide | Abnova Corporation | |
713108 | U0227 | Fluorescent Dye 678-C5.5 NHS Ester | Abnova Corporation | |
713107 | U0226 | Fluorescent Dye 678-C5.5 Acid | Abnova Corporation | |
713106 | U0225 | Fluorescent Dye 678-C5.5 bisAcid | Abnova Corporation | |
713105 | U0224 | Fluorescent Dye 749-C7 bisNHS Ester | Abnova Corporation | |
713104 | U0223 | Fluorescent Dye 749-C7 bisAcid | Abnova Corporation | |
713103 | U0222 | Fluorescent Dye 749-C7 Hydrazide | Abnova Corporation | |
713102 | U0221 | Fluorescent Dye 749-C7 Amine | Abnova Corporation | |
713101 | U0220 | Fluorescent Dye 749-C7 Alkyne | Abnova Corporation | |
713100 | U0219 | Fluorescent Dye 749-C7 Azide | Abnova Corporation | |
713099 | U0218 | Fluorescent Dye 749-C7 Maleimide | Abnova Corporation | |
713098 | U0217 | Fluorescent Dye 749-C7 NHS Ester | Abnova Corporation | |
713097 | U0216 | Fluorescent Dye 749-C7 Acid | Abnova Corporation | |
713096 | U0215 | Fluorescent Dye 678-C5.5 bisNHS Ester | Abnova Corporation | |
713095 | U0214 | Fluorescent Dye 649-C5 bisNHS Ester | Abnova Corporation | |
713094 | U0213 | Fluorescent Dye 649-C5 Hydrazide | Abnova Corporation | |
713093 | U0212 | Fluorescent Dye 649-C5 Amine | Abnova Corporation | |
713092 | U0211 | Fluorescent Dye 649-C5 Alkyne | Abnova Corporation | |
713091 | U0210 | Fluorescent Dye 649-C5 Azide | Abnova Corporation | |
713090 | U0209 | Fluorescent Dye 649-C5 Maleimide | Abnova Corporation | |
713089 | U0208 | Fluorescent Dye 649-C5 NHS Ester | Abnova Corporation | |
713088 | U0207 | Fluorescent Dye 649-C5 Acid | Abnova Corporation | |
713087 | U0206 | Fluorescent Dye 581-C3.5 Maleimide | Abnova Corporation | |
713086 | U0205 | Fluorescent Dye 581-C3.5 NHS Ester | Abnova Corporation | |
713085 | U0204 | Fluorescent Dye 581-C3.5 Acid | Abnova Corporation | |
713084 | U0203 | Fluorescent Dye 555-C3 Hydrazide | Abnova Corporation | |
713083 | U0202 | Fluorescent Dye 555-C3 Amine | Abnova Corporation | |
713082 | U0201 | Fluorescent Dye 555-C3 Alkyne | Abnova Corporation | |
713081 | U0200 | Fluorescent Dye 555-C3 Azide | Abnova Corporation | |
713080 | U0199 | Fluorescent Dye 555-C3 Maleimide | Abnova Corporation | |
713079 | U0198 | Fluorescent Dye 555-C3 NHS Ester | Abnova Corporation | |
713078 | U0197 | Fluorescent Dye 555-C3 Acid | Abnova Corporation | |
713077 | U0196 | Fluorescent Dye 581-C3.5 Amine | Abnova Corporation | |
713042 | U0161 | Fluorescent Dye 645-A Amine | Abnova Corporation | |
709615 | U0031 | DAPI Counterstain (1500ng/ml) | Abnova Corporation | |
709614 | U0030 | DAPI Counterstain (150ng/ml) | Abnova Corporation | |
689478 | CDX-C0003 | BCECF-AM | Chemodex | |
681913 | CDX-Q0011 | Quinacrine mustard dihydrochloride | Chemodex | |
681905 | CDX-F0039 | Fluorescein diacetate 6-maleimide | Chemodex | |
681904 | CDX-F0018 | Fluorescein diacetate 5-maleimide | Chemodex | |
681891 | CDX-C0002 | BCECF acid | Chemodex | |
681889 | CDX-A0055 | 5-Aminoeosin | Chemodex | |
644152 | CDX-Z0014 | Zinquin free acid | Chemodex | |
644149 | CDX-Z0013 | Zinquin ethyl ester | Chemodex | |
644146 | CDX-Z0012 | ZnAF-2F DA | Chemodex | |
644143 | CDX-Z0011 | ZnAF-1F DA | Chemodex | |
644140 | CDX-Z0010 | ZnAF-2F | Chemodex | |
644137 | CDX-Z0009 | ZnAF-1F | Chemodex | |
644134 | CDX-Z0008 | ZnAF-2 DA | Chemodex | |
644131 | CDX-Z0007 | ZnAF-1 DA | Chemodex | |
644128 | CDX-Z0005 | ZnAF-1 | Chemodex | |
644126 | CDX-Z0001 | Zinpyr-1 | Chemodex | |
644111 | CDX-T0083 | meso-Tetraphenyl-tetrabenzoporphine palladium complex | Chemodex | |
644104 | CDX-T0046 | JC-1 | Chemodex | |
644099 | CDX-T0035 | 6-TRITC | Chemodex | |
644098 | CDX-T0034 | 5-TRITC | Chemodex | |
644095 | CDX-T0030 | Tetramethylrhodamine-6-maleimide | Chemodex | |
644092 | CDX-T0029 | Tetramethylrhodamine-5-maleimide | Chemodex | |
644091 | CDX-T0027 | 3,4,5,6-Tetramethylpyridazin | Chemodex | |
644085 | CDX-T0013 | Thiazol Orange | Chemodex | |
644083 | CDX-T0011 | TRITC | Chemodex | |
644081 | CDX-T0007 | 4-(Trifluoromethyl)umbelliferyl phosphate | Chemodex | |
644069 | CDX-S0031 | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxazolyl)-pyridinium bromide | Chemodex | |
644066 | CDX-S0030 | N-(3-Succinimidyloxy-carbonyl-phenyl)-methyl-4-(5'-(4''-methoxy-phenyl)-2'-oxazolyl)-pyridinium bromide | Chemodex | |
644060 | CDX-S0008 | Sulforhodamine 101 acid chloride | Chemodex | |
644057 | CDX-R0051 | Resazurin sodium salt | Chemodex | |
644054 | CDX-R0044 | Resorufin butyrate | Chemodex | |
644052 | CDX-R0029 | [Ru(bpy)2(5-iodoacetamido-1,10-phenanthroline)](PF6)2 | Chemodex | |
644050 | CDX-R0028 | [Ru(bpy)2(5-chloroacetamido-1,10-phenanthroline)](PF6)2 | Chemodex | |
644049 | CDX-R0025 | Rhodamine 6G bis(aminoethyl)amine amide bis (trifluoroacetate) | Chemodex | |
644047 | CDX-R0024 | Rhodamine 6G p-diaminoxylene amide bis (trifluoroacetate) | Chemodex | |
644045 | CDX-R0023 | Rhodamine 6G bis(oxyethylamino)ethane amide bis (trifluoroacetate) | Chemodex | |
644037 | CDX-R0018 | Bis(2,2'-bipyridine)-(5-isothiocyanato-phenanthroline)ruthenium bis(hexafluorophosphate) | Chemodex | |
644034 | CDX-R0013 | Resorufin ethyl ether | Chemodex | |
644028 | CDX-Q0012 | Quinine (anhydrous) | Chemodex | |
644024 | CDX-P0118 | Pyridoxal hydrochloride | Chemodex | |
644012 | CDX-P0023 | Propidium iodide | Chemodex | |
644007 | CDX-P0019 | Oxonol V | Chemodex | |
643996 | CDX-P0009 | Physil chloride | Chemodex | |
643982 | CDX-O0027 | N-Octadecanoyl-Nile Blue | Chemodex | |
643981 | CDX-O0022 | Rhodamine B octadecyl ester perchlorate | Chemodex | |
643978 | CDX-O0018 | 10-Octadecylacridine orange bromide | Chemodex | |
643975 | CDX-O0007 | 4-Methylumbelliferyl heptanoate | Chemodex | |
643973 | CDX-O0006 | Oenanthacid-4-(trifluormethyl)-umbelliferone | Chemodex | |
643971 | CDX-N0053 | 2-(2-Naphthyl)-2-pentyloxyethanenitrile | Chemodex | |
643967 | CDX-N0014 | NBD-PZ | Chemodex | |
643964 | CDX-N0013 | NBD-dodecanoic acid | Chemodex | |
643963 | CDX-N0011 | NBD-undecanoic acid | Chemodex | |
643961 | CDX-N0008 | NIR-797-isothiocyanate | Chemodex | |
643956 | CDX-N0005 | NBD-X | Chemodex | |
643939 | CDX-M0118 | 2-(4-Aminophenyl)-6-methylbenzothiazole-7-sulphonic acid | Chemodex | |
643938 | CDX-M0117 | N-(4-Methylumbelliferyl)-maleinimide | Chemodex | |
643934 | CDX-M0086 | 4-Methylumbelliferyl oleate | Chemodex | |
643931 | CDX-M0081 | N-(N'-Maleinimidyl-2-ethyl)-4-(2-(6-(3,4-dihydro-2H-1-benzopyranyl))-5-oxyzolyl) pyridinium triflate | Chemodex | |
643928 | CDX-M0080 | 1-[2-(Maleimido)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium triflate | Chemodex | |
643920 | CDX-M0072 | 2-Methoxy-2-(2-naphthyl)ethanenitrile | Chemodex | |
643918 | CDX-M0071 | 1-[2-(6-Methoxy-3-oxo-3H-xanthen-9-yl)-benzoyl]-piperidine-4-carboxylic acid | Chemodex | |
643916 | CDX-M0055 | MPTS | Chemodex | |
643913 | CDX-M0049 | 5-Methoxy-2,3,3-trimethyl-1-(4-sulfobutyl)-indolium, inner salt | Chemodex | |
643909 | CDX-M0033 | Merocyanin 540 | Chemodex | |
643902 | CDX-M0019 | 7-Methoxy-4-coumarinylacetic acid N-succinimidyl ester | Chemodex | |
643900 | CDX-M0018 | 7-Methoxycoumarin-3-carbonyl azide | Chemodex | |
643897 | CDX-M0017 | 7-Methoxycoumarin-3-carboxylic acid N-succinimidyl ester | Chemodex | |
643895 | CDX-M0016 | 7-Methoxycoumarin-3-carboxylic acid | Chemodex | |
643893 | CDX-M0015 | 7-Methoxy-4-(trifluoromethyl)coumarin | Chemodex | |
643890 | CDX-M0013 | 5-Maleimido-eosin | Chemodex | |
643889 | CDX-M0011 | 4-Methylumbelliferyl butyrate | Chemodex | |
643886 | CDX-M0010 | 4-Methylumbelliferyl acetate | Chemodex | |
643883 | CDX-M0006 | 4-[4'-(2'-Methyl)thiazolyl]phenol | Chemodex | |
643881 | CDX-M0005 | NBD-methylhydrazine | Chemodex | |
643879 | CDX-M0004 | M-Phisyl-chloride | Chemodex | |
643864 | CDX-I0036 | N-(3-Isothiocyanatopropyl)-4-(5'-(4''-methoxyphenyl)-2'-oxazolyl) pyridinium bromide | Chemodex | |
643862 | CDX-I0035 | 1-(2-Isothiocyanatoethyl)-4-[2-(3,4-dihydro-2H-1-benzopyranyl-6-yl)-5-oxazolyl]pyridinium bromide | Chemodex | |
643857 | CDX-I0034 | 1-(3-Isothiocyanatobenzyl)-4-[2-(3,4-dihydro-2H-1-benzopyran-6-yl)-5-oxazolyl] pyridinium bromide | Chemodex | |
643854 | CDX-I0033 | 1-[2-(4-Isothiocyanatophenoxy)ethyl]-4-[5-(4-methoxyphenyl)-2-oxazolyl] pyridinium tosylate | Chemodex | |
643851 | CDX-I0032 | 1-(2-Isothiocyanatoethyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | Chemodex | |
643850 | CDX-I0022 | N-(3-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | Chemodex | |
643848 | CDX-I0021 | 6-IAF | Chemodex | |
643845 | CDX-I0018 | Indo-1 pentapotassium salt | Chemodex | |
643842 | CDX-I0015 | N-(4-Isothiocyanatobenzyl)-4-[5-(4-methoxyphenyl)-2-oxazolyl]pyridinium bromide | Chemodex | |
643839 | CDX-I0005 | 7-(Isobutyloxycarbonyloxy)-3H-phenoxazin-3-one | Chemodex | |
643838 | CDX-I0004 | IPB | Chemodex | |
643822 | CDX-H0043 | 8-Hydroxy-N,N,N',N',N'',N''-hexamethyl-pyrene-1,3,6-trisulfonamide | Chemodex | |
643821 | CDX-H0041 | BHHCT | Chemodex | |
643816 | CDX-H0034 | HPTS | Chemodex | |
643813 | CDX-H0003 | HCPI | Chemodex | |
643799 | CDX-F0213 | 4-Fluoro-2,1,3-benzoxadiazol | Chemodex | |
643789 | CDX-F0074 | Fluorescein octadecyl ester | Chemodex | |
643788 | CDX-F0057 | Fluorescein dibutyrate | Chemodex | |
643780 | CDX-F0033 | Fluo-3 AM | Chemodex | |
643777 | CDX-F0029 | 5(6)-FITC DA | Chemodex | |
643776 | CDX-F0028 | 6-FITC DA | Chemodex | |
643773 | CDX-F0022 | FOAA | Chemodex | |
643770 | CDX-F0017 | NBD-F | Chemodex | |
643768 | CDX-F0016 | ABD-F | Chemodex | |
643760 | CDX-F0010 | 5(6)-FITC | Chemodex | |
643753 | CDX-F0006 | 5-FITC DA | Chemodex | |
643750 | CDX-F0005 | Fluorescein-5-thiosemicarbazide | Chemodex | |
643747 | CDX-F0004 | N-(5-Fluoresceinyl)-maleinimide | Chemodex | |
643745 | CDX-F0002 | SBD-F | Chemodex | |
643742 | CDX-F0001 | 3-(2-Furoyl)quinoline-2-carboxaldehyde | Chemodex | |
643736 | CDX-E0031 | 2-Ethoxy-2-(2-naphthyl)-acetonitrile | Chemodex | |
643732 | CDX-E0006 | ASPT | Chemodex | |
643730 | CDX-E0004 | 7-Ethoxy-4-methylcoumarin | Chemodex | |
643725 | CDX-E0001 | MQAE | Chemodex | |
643711 | CDX-D0296 | Fluorescin | Chemodex | |
643693 | CDX-D0230 | 1,1'-Dioctadecyl-3,3,3',3'-tetramethylindocarbocyanine perchlorate | Chemodex | |
643685 | CDX-D0199 | 7-Diethylamino-3-[N-(4-maleimidopropyl)carbamoyl]coumarin | Chemodex | |
643682 | CDX-D0198 | 7-Diethylamino-3-[N-(4-maleimidoethyl)carbamoyl]coumarin | Chemodex | |
643680 | CDX-D0134 | Dihydrorhodamine 123 | Chemodex | |
643675 | CDX-D0122 | Dihydrofluorescein diacetate | Chemodex | |
643669 | CDX-D0102 | DAR-2 | Chemodex | |
643666 | CDX-D0101 | DAR-1 | Chemodex | |
643663 | CDX-D0099 | FAMC | Chemodex | |
643662 | CDX-D0098 | Laurdan | Chemodex | |
643660 | CDX-D0094 | Dihydroethidium | Chemodex | |
643656 | CDX-D0090 | DCIA | Chemodex | |
643655 | CDX-D0087 | 2',7'-Difluorofluorescein | Chemodex | |
643651 | CDX-D0085 | DAF-2 DA | Chemodex |